EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19N3O2 |
| Net Charge | 0 |
| Average Mass | 333.391 |
| Monoisotopic Mass | 333.14773 |
| SMILES | CCOc1ccc2nc3cc(NCc4ccco4)ccc3c(N)c2c1 |
| InChI | InChI=1S/C20H19N3O2/c1-2-24-14-6-8-18-17(11-14)20(21)16-7-5-13(10-19(16)23-18)22-12-15-4-3-9-25-15/h3-11,22H,2,12H2,1H3,(H2,21,23) |
| InChIKey | PGNWQNJXXLPZEL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | WNK signaling inhibitor A substance that inhibits any of the WNK signalling pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-ethoxy-N3-(2-furanylmethyl)-3,9-acridinediamine (CHEBI:228283) has role WNK signaling inhibitor (CHEBI:228284) |
| 7-ethoxy-N3-(2-furanylmethyl)-3,9-acridinediamine (CHEBI:228283) is a aminoacridines (CHEBI:51803) |
| 7-ethoxy-N3-(2-furanylmethyl)-3,9-acridinediamine (CHEBI:228283) is a aromatic amine (CHEBI:33860) |
| 7-ethoxy-N3-(2-furanylmethyl)-3,9-acridinediamine (CHEBI:228283) is a aromatic ether (CHEBI:35618) |
| 7-ethoxy-N3-(2-furanylmethyl)-3,9-acridinediamine (CHEBI:228283) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 7-ethoxy-N3-(furan-2-ylmethyl)acridine-3,9-diamine |
| Synonyms | Source |
|---|---|
| 7-ethoxy-N3-[(furan-2-yl)methyl]acridine-3,9-diamine | IUPAC |
| compound B | ChEBI |
| STOCK2S 26016 | ChEBI |
| STOCK2S-26016 | ChEBI |
| WNK IN B | ChEBI |
| WNK-IN-B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:332922-63-1 | ChEBI |
| Citations |
|---|