EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17NO2 |
| Net Charge | 0 |
| Average Mass | 147.218 |
| Monoisotopic Mass | 147.12593 |
| SMILES | CCOC(CCN)OCC |
| InChI | InChI=1S/C7H17NO2/c1-3-9-7(5-6-8)10-4-2/h7H,3-6,8H2,1-2H3 |
| InChIKey | PXXMSHBZYAOHBD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:960) | - | MetaboLights (MTBLS8090) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-amino-3,3-diethoxypropane (CHEBI:228279) is a diether (CHEBI:46786) |
| 1-amino-3,3-diethoxypropane (CHEBI:228279) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 3,3-diethoxypropan-1-amine |
| Synonyms | Source |
|---|---|
| 3,3-diethoxy-1-propaneamine | ChEBI |
| 3,3-diethoxypropylamine | NIST Chemistry WebBook |
| 3-aminopropionaldehyde diethylacetal | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:41365-75-7 | NIST Chemistry WebBook |
| Citations |
|---|