EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O6 |
| Net Charge | -2 |
| Average Mass | 256.214 |
| Monoisotopic Mass | 256.07063 |
| SMILES | [H][C@@]1(CCC(=O)[O-])N=C(O)[C@]([H])(CCC(=O)[O-])N=C1O |
| InChI | InChI=1S/C10H14N2O6/c13-7(14)3-1-5-9(17)12-6(10(18)11-5)2-4-8(15)16/h5-6H,1-4H2,(H,11,18)(H,12,17)(H,13,14)(H,15,16)/p-2/t5-,6-/m0/s1 |
| InChIKey | NDCKGUDRHBPJAQ-WDSKDSINSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS8090) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclo(Glu-Glu) (CHEBI:228276) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| 3-[(2S,5S)-5-(2-carboxylatoethyl)-3,6-dioxopiperazin-2-yl]propanoate |
| Synonym | Source |
|---|---|
| cyclo(L-glutamyl-L-glutamyl) | SUBMITTER |