EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38Cl2N4O4 |
| Net Charge | 0 |
| Average Mass | 577.553 |
| Monoisotopic Mass | 576.22701 |
| SMILES | O=C1COc2c(CCNCCN(C(=O)CCNCCc3ccc(Cl)c(Cl)c3)C3CCCCC3)ccc(O)c2N1 |
| InChI | InChI=1S/C29H38Cl2N4O4/c30-23-8-6-20(18-24(23)31)10-13-32-15-12-27(38)35(22-4-2-1-3-5-22)17-16-33-14-11-21-7-9-25(36)28-29(21)39-19-26(37)34-28/h6-9,18,22,32-33,36H,1-5,10-17,19H2,(H,34,37) |
| InChIKey | LIBVHXXKHSODII-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.1.1.354 ([histone H3]-lysine(4) N-trimethyltransferase) inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of [histone H3]-lysine4 N-trimethyltransferase (EC 2.1.1.354). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZ505 (CHEBI:228259) has role antineoplastic agent (CHEBI:35610) |
| AZ505 (CHEBI:228259) has role EC 2.1.1.354 ([histone H3]-lysine4 N-trimethyltransferase) inhibitor (CHEBI:228263) |
| AZ505 (CHEBI:228259) is a benzoxazine (CHEBI:46969) |
| AZ505 (CHEBI:228259) is a dichlorobenzene (CHEBI:23697) |
| AZ505 (CHEBI:228259) is a organic hydroxy compound (CHEBI:33822) |
| AZ505 (CHEBI:228259) is a secondary amino compound (CHEBI:50995) |
| AZ505 (CHEBI:228259) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| N-cyclohexyl-N3-[2-(3,4-dichlorophenyl)ethyl]-N-(2-{[2-(5-hydroxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-8-yl)ethyl]amino}ethyl)-β-alaninamide |
| Synonyms | Source |
|---|---|
| N-cyclohexyl-3-[2-(3,4-dichlorophenyl)ethylamino]-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]propanamide | SUBMITTER |
| AZ 505 | ChEBI |
| AZ-505 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1035227-43-0 | SUBMITTER |
| Citations |
|---|