EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H42N6O |
| Net Charge | 0 |
| Average Mass | 574.773 |
| Monoisotopic Mass | 574.34201 |
| SMILES | Cc1cn(CCN2CCN(c3ccccc3-c3cc(C#N)cc(C(=O)NCCCN4CCCC4)c3)CC2)c2ccccc12 |
| InChI | InChI=1S/C36H42N6O/c1-28-27-42(34-11-4-2-9-32(28)34)22-19-40-17-20-41(21-18-40)35-12-5-3-10-33(35)30-23-29(26-37)24-31(25-30)36(43)38-13-8-16-39-14-6-7-15-39/h2-5,9-12,23-25,27H,6-8,13-22H2,1H3,(H,38,43) |
| InChIKey | PNYRDVBFYVDJJI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.1.1.354 ([histone H3]-lysine(4) N-trimethyltransferase) inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of [histone H3]-lysine4 N-trimethyltransferase (EC 2.1.1.354). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LLY-507 (CHEBI:228258) has role EC 2.1.1.354 ([histone H3]-lysine4 N-trimethyltransferase) inhibitor (CHEBI:228263) |
| LLY-507 (CHEBI:228258) is a N-alkylpiperazine (CHEBI:46845) |
| LLY-507 (CHEBI:228258) is a N-alkylpyrrolidine (CHEBI:46775) |
| LLY-507 (CHEBI:228258) is a N-arylpiperazine (CHEBI:46848) |
| LLY-507 (CHEBI:228258) is a benzamides (CHEBI:22702) |
| LLY-507 (CHEBI:228258) is a methylindole (CHEBI:38460) |
| LLY-507 (CHEBI:228258) is a nitrile (CHEBI:18379) |
| LLY-507 (CHEBI:228258) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 5-cyano-2'-{4-[2-(3-methyl-1H-indol-1-yl)ethyl]piperazin-1-yl}-N-[3-(pyrrolidin-1-yl)propyl][biphenyl]-3-carboxamide |
| Synonyms | Source |
|---|---|
| LLY507 | ChEBI |
| LLY 507 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1793053-37-8 | SUBMITTER |
| Citations |
|---|