EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5O4 |
| Net Charge | -1 |
| Average Mass | 117.080 |
| Monoisotopic Mass | 117.01933 |
| SMILES | C[C@H](O)C(=O)C(=O)[O-] |
| InChI | InChI=1S/C4H6O4/c1-2(5)3(6)4(7)8/h2,5H,1H3,(H,7,8)/p-1/t2-/m0/s1 |
| InChIKey | QWZIITCYKKSZGN-REOHCLBHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-hydroxy-2-oxobutanoate (CHEBI:228256) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| (S)-3-hydroxy-2-oxobutanoate (CHEBI:228256) is enantiomer of (R)-3-hydroxy-2-oxobutanoate (CHEBI:228257) |
| Incoming Relation(s) |
| (R)-3-hydroxy-2-oxobutanoate (CHEBI:228257) is enantiomer of (S)-3-hydroxy-2-oxobutanoate (CHEBI:228256) |
| Synonym | Source |
|---|---|
| (3S)-3-hydroxy-2-oxobutanoate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (S)-3-hydroxy-2-oxobutanoate | UniProt |
| Citations |
|---|