EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16N2O3 |
| Net Charge | 0 |
| Average Mass | 320.348 |
| Monoisotopic Mass | 320.11609 |
| SMILES | Cc1ccc(/C=N/NC(=O)c2ccccc2Oc2ccccc2)o1 |
| InChI | InChI=1S/C19H16N2O3/c1-14-11-12-16(23-14)13-20-21-19(22)17-9-5-6-10-18(17)24-15-7-3-2-4-8-15/h2-13H,1H3,(H,21,22)/b20-13+ |
| InChIKey | JJEDWBQZCRESJL-DEDYPNTBSA-N |
| Roles Classification |
|---|
| Biological Role: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PNU-74654 (CHEBI:228251) has role Wnt signalling inhibitor (CHEBI:78031) |
| PNU-74654 (CHEBI:228251) is a aromatic ether (CHEBI:35618) |
| PNU-74654 (CHEBI:228251) is a carbohydrazide (CHEBI:35363) |
| PNU-74654 (CHEBI:228251) is a furans (CHEBI:24129) |
| Synonyms | Source |
|---|---|
| Benzoic acid, 2-phenoxy-, 2-[(5-methyl-2-furanyl)methylene]hydrazide | SUBMITTER |
| PNU 74654 | ChEBI |
| PNU74654 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:113906-27-7 | SUBMITTER |