EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19ClN4O |
| Net Charge | 0 |
| Average Mass | 366.852 |
| Monoisotopic Mass | 366.12474 |
| SMILES | CC1N[C@H](C(=O)N/N=C/c2ccc(Cl)cc2)Cc2c1nc1ccccc21 |
| InChI | InChI=1S/C20H19ClN4O/c1-12-19-16(15-4-2-3-5-17(15)24-19)10-18(23-12)20(26)25-22-11-13-6-8-14(21)9-7-13/h2-9,11-12,18,23-24H,10H2,1H3,(H,25,26)/b22-11+/t12?,18-/m0/s1 |
| InChIKey | KMNVHTXBKWKMBA-KMRULJOSSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. fungicide A substance used to destroy fungal pests. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloroinconazide (CHEBI:228238) has role antiviral agent (CHEBI:22587) |
| chloroinconazide (CHEBI:228238) has role fungicide (CHEBI:24127) |
| chloroinconazide (CHEBI:228238) is a carbohydrazide (CHEBI:35363) |
| chloroinconazide (CHEBI:228238) is a monochlorobenzenes (CHEBI:83403) |
| chloroinconazide (CHEBI:228238) is a β-carbolines (CHEBI:60834) |
| IUPAC Name |
|---|
| (1RS,3S)-N'-[(E)-(4-chlorobenzylidene)]-2,3,4,9-tetrahydro-1-methyl-1H-pyrido[3,4-b]indole-3-carbohydrazide |
| Synonyms | Source |
|---|---|
| (3S)-N'-[(E)-(4-chlorophenyl)methylidene]-1-methyl-2,3,4,9-tetrahydro-1H-β-carboline-3-carbohydrazide | IUPAC |
| (3S)-2,3,4,9-tetrahydro-1-methyl-1H-pyrido[3,4-b]indole-3-carboxylic acid (2E)-2-[(4-chlorophenyl)methylene]hydrazide | Alan Wood's Pesticides |
| (1Ξ,3S)-N'-[(E)-(4-chlorophenyl)methylidene]-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbohydrazide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 3464 | PPDB |
| chloroinconazide | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:55193976 | Reaxys |
| CAS:2442449-10-5 | Alan Wood's Pesticides |
| Citations |
|---|