EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@@]12C[C@@]3(C)CCC(C)(C)[C@@]3([H])[C@]1([H])CC[C@@]1(C)[C@H](O)CC[C@@]21C |
| InChI | InChI=1S/C20H34O/c1-17(2)10-11-18(3)12-14-13(16(17)18)6-8-20(5)15(21)7-9-19(14,20)4/h13-16,21H,6-12H2,1-5H3/t13-,14-,15-,16-,18-,19+,20+/m1/s1 |
| InChIKey | OCXPFFUCZOJOKO-FQJWRULHSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fusaterpenol (CHEBI:228228) has role fungal metabolite (CHEBI:76946) |
| fusaterpenol (CHEBI:228228) is a carbotetracyclic compound (CHEBI:177332) |
| fusaterpenol (CHEBI:228228) is a diterpenoid (CHEBI:23849) |
| fusaterpenol (CHEBI:228228) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3R,3aR,5aR,5bR,8aR,9aR,9bS)-3a,6,6,8a,9b-pentamethyltetradecahydro-1H-cyclopenta[b]-as-indacen-3-ol |
| Synonyms | Source |
|---|---|
| GJ1012-E | ChEBI |
| GJ1012E | ChEBI |
| GJ1012 E | ChEBI |
| Citations |
|---|