EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40 |
| Net Charge | 0 |
| Average Mass | 340.595 |
| Monoisotopic Mass | 340.31300 |
| SMILES | [H][C@@]12CC[C@H](C)[C@@]13CC[C@H](C)C3=C[C@@]1(C)CC[C@](C)(CCC=C(C)C)[C@@]21[H] |
| InChI | InChI=1S/C25H40/c1-17(2)8-7-12-23(5)14-15-24(6)16-21-18(3)11-13-25(21)19(4)9-10-20(25)22(23)24/h8,16,18-20,22H,7,9-15H2,1-6H3/t18-,19-,20-,22+,23-,24+,25-/m0/s1 |
| InChIKey | GXADVMWFZQPEDX-PHNLQQBUSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mangicdiene (CHEBI:228226) has role fungal metabolite (CHEBI:76946) |
| mangicdiene (CHEBI:228226) is a carbotetracyclic compound (CHEBI:177332) |
| mangicdiene (CHEBI:228226) is a polycyclic olefin (CHEBI:35714) |
| mangicdiene (CHEBI:228226) is a sesterterpene (CHEBI:35192) |
| IUPAC Name |
|---|
| (3S,3aS,6S,7aR,10S,10aR,10bS)-3,6,7a,10-tetramethyl-10-(4-methylpent-3-en-1-yl)-1,2,3,4,5,6,7a,8,9,10,10a,10b-dodecahydrocyclopenta[d]-s-indacene |
| Citations |
|---|