EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO |
| Net Charge | 0 |
| Average Mass | 139.198 |
| Monoisotopic Mass | 139.09971 |
| SMILES | [H]C(=O)C1CCN2CCCC12 |
| InChI | InChI=1S/C8H13NO/c10-6-7-3-5-9-4-1-2-8(7)9/h6-8H,1-5H2 |
| InChIKey | LUXKVBLHJUGCSC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-formylpyrrolizidine (CHEBI:228222) is a aliphatic aldehyde (CHEBI:59768) |
| 1-formylpyrrolizidine (CHEBI:228222) is a pyrrolizidine alkaloid (CHEBI:64948) |
| 1-formylpyrrolizidine (CHEBI:228222) is conjugate base of 1-formylpyrrolizidine(1+) (CHEBI:228186) |
| Incoming Relation(s) |
| 1-formylpyrrolizidine(1+) (CHEBI:228186) is conjugate acid of 1-formylpyrrolizidine (CHEBI:228222) |
| IUPAC Name |
|---|
| hexahydro-1H-pyrrolizine-1-carbaldehyde |
| Citations |
|---|