EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H22N2O5 |
| Net Charge | 0 |
| Average Mass | 418.449 |
| Monoisotopic Mass | 418.15287 |
| SMILES | Cc1cccc(C)c1-n1c(=O)c2cc(C(=O)C3=C(O)CCCC3=O)ccc2n(C)c1=O |
| InChI | InChI=1S/C24H22N2O5/c1-13-6-4-7-14(2)21(13)26-23(30)16-12-15(10-11-17(16)25(3)24(26)31)22(29)20-18(27)8-5-9-19(20)28/h4,6-7,10-12,27H,5,8-9H2,1-3H3 |
| InChIKey | IFHRYUOSJUERAZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the activity of 4-hydroxyphenylpyruvate dioxygenase (EC 1.13.11.27). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benquitrione (CHEBI:228214) has role EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor (CHEBI:38317) |
| benquitrione (CHEBI:228214) has role herbicide (CHEBI:24527) |
| benquitrione (CHEBI:228214) is a aromatic ketone (CHEBI:76224) |
| benquitrione (CHEBI:228214) is a cyclohexenones (CHEBI:48953) |
| benquitrione (CHEBI:228214) is a enol (CHEBI:33823) |
| benquitrione (CHEBI:228214) is a enone (CHEBI:51689) |
| benquitrione (CHEBI:228214) is a methylbenzene (CHEBI:38975) |
| benquitrione (CHEBI:228214) is a quinazolines (CHEBI:38530) |
| IUPAC Name |
|---|
| 3-(2,6-dimethylphenyl)-6-[(2-hydroxy-6-oxocyclohex-1-en-1-yl)carbonyl]-1-methylquinazoline-2,4(1H,3H)-dione |
| Synonyms | Source |
|---|---|
| 3-(2,6-dimethylphenyl)-6-(2-hydroxy-6-oxocyclohex-1-ene-1-carbonyl)-1-methylquinazoline-2,4(1H,3H)-dione | IUPAC |
| 3-(2,6-dimethylphenyl)-6-[2-hydroxy-6-oxo(cyclohex-1-ene-1-carbonyl)]-1-methylquinazoline-2,4(1H,3H)-dione | Alan Wood's Pesticides |
| 6-[(2-hydroxy-6-oxocyclohex-1-en-1-yl)carbonyl]-1-methyl-3-(2,6-xylyl)quinazoline-2,4(1H,3H)-dione | Alan Wood's Pesticides |
| 3-(2,6-dimethylphenyl)-6-[(2-hydroxy-6-oxo-1-cyclohexen-1-yl)carbonyl]-1-methyl-2,4(1H,3H)-quinazolinedione | Alan Wood's Pesticides |
| quinotrione | PPDB |
| Y13161 | PPDB |
| Manual Xrefs | Databases |
|---|---|
| benquitrione | Alan Wood's Pesticides |
| 3345 | PPDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1639426-14-4 | Alan Wood's Pesticides |
| Citations |
|---|