EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H33N3O5S |
| Net Charge | 0 |
| Average Mass | 547.677 |
| Monoisotopic Mass | 547.21409 |
| SMILES | C[C@@H]1CN(CC(=O)Nc2ccc3c(c2)Cc2cccc(-c4cc(=O)cc(N5CCOCC5)o4)c2S3)C[C@H](C)O1 |
| InChI | InChI=1S/C30H33N3O5S/c1-19-16-32(17-20(2)37-19)18-28(35)31-23-6-7-27-22(13-23)12-21-4-3-5-25(30(21)39-27)26-14-24(34)15-29(38-26)33-8-10-36-11-9-33/h3-7,13-15,19-20H,8-12,16-18H2,1-2H3,(H,31,35)/t19-,20+ |
| InChIKey | SCELLOWTHJGVIC-BGYRXZFFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| KU-60019 (CHEBI:228206) has role antineoplastic agent (CHEBI:35610) |
| KU-60019 (CHEBI:228206) has role autophagy inducer (CHEBI:138880) |
| KU-60019 (CHEBI:228206) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| KU-60019 (CHEBI:228206) has role radiosensitizing agent (CHEBI:132992) |
| KU-60019 (CHEBI:228206) is a 4-pyranones (CHEBI:131906) |
| KU-60019 (CHEBI:228206) is a morpholines (CHEBI:38785) |
| KU-60019 (CHEBI:228206) is a secondary carboxamide (CHEBI:140325) |
| KU-60019 (CHEBI:228206) is a tertiary amino compound (CHEBI:50996) |
| KU-60019 (CHEBI:228206) is a thioxanthenes (CHEBI:50930) |
| IUPAC Name |
|---|
| 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-{5-[6-(morpholin-4-yl)-4-oxo-4H-pyran-2-yl]-9H-thioxanthen-2-yl}acetamide |
| Synonyms | Source |
|---|---|
| KU 60019 | ChEBI |
| KU60019 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1156 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:925701-46-8 | ChEBI |
| CAS:925701-49-1 | ChEBI |
| Citations |
|---|