EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H54O |
| Net Charge | 0 |
| Average Mass | 382.717 |
| Monoisotopic Mass | 382.41747 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCC(O)CC |
| InChI | InChI=1S/C26H54O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)4-2/h26-27H,3-25H2,1-2H3 |
| InChIKey | XGMKXPJGMIYYNI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Syzygium aromaticum (ncbitaxon:219868) | - | PubMed (34221080) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexacosan-3-ol (CHEBI:228191) has role plant metabolite (CHEBI:76924) |
| hexacosan-3-ol (CHEBI:228191) is a hexacosanol (CHEBI:228187) |
| hexacosan-3-ol (CHEBI:228191) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| hexacosan-3-ol |
| Synonyms | Source |
|---|---|
| 3-hexacosanol | ChEBI |
| 3-hydroxyhexacosane | ChEBI |
| Citations |
|---|