EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H52O |
| Net Charge | 0 |
| Average Mass | 368.690 |
| Monoisotopic Mass | 368.40182 |
| SMILES | CCCCCCCCCCCCC(O)CCCCCCCCCCCC |
| InChI | InChI=1S/C25H52O/c1-3-5-7-9-11-13-15-17-19-21-23-25(26)24-22-20-18-16-14-12-10-8-6-4-2/h25-26H,3-24H2,1-2H3 |
| InChIKey | VQPXKBBANDVCGT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ferula sumbul (ncbitaxon:371383) | Root (BTO:0001188) | DOI (10.1080/22311866.2018.1472037) | |
| Melanoplus packardii (ncbitaxon:103651) | - | DOI (10.1007/BF02532655) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentacosan-13-ol (CHEBI:228184) has role animal metabolite (CHEBI:75767) |
| pentacosan-13-ol (CHEBI:228184) has role anxiolytic drug (CHEBI:35474) |
| pentacosan-13-ol (CHEBI:228184) has role plant metabolite (CHEBI:76924) |
| pentacosan-13-ol (CHEBI:228184) is a pentacosanol (CHEBI:228171) |
| pentacosan-13-ol (CHEBI:228184) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| pentacosan-13-ol |
| Synonyms | Source |
|---|---|
| 13-pentacosanol | ChEBI |
| 13-hydroxypentacosane | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:138966-97-9 | ChEBI |
| Citations |
|---|