EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18ClN7O7S |
| Net Charge | 0 |
| Average Mass | 475.871 |
| Monoisotopic Mass | 475.06769 |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2c(C3=NOC[C@@H](C)O3)c(Cl)nn2C)n1 |
| InChI | InChI=1S/C15H18ClN7O7S/c1-7-6-29-21-12(30-7)10-11(16)20-23(2)13(10)31(25,26)22-15(24)19-14-17-8(27-3)5-9(18-14)28-4/h5,7H,6H2,1-4H3,(H2,17,18,19,22,24)/t7-/m1/s1 |
| InChIKey | IXWKBUKANTXHJH-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-metazosulfuron (CHEBI:228162) is a 3-chloro-N-[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]-1-methyl-4-(5-methyl-5,6-dihydro-1,4,2-dioxazin-3-yl)-1H-pyrazole-5-sulfonamide (CHEBI:228164) |
| (R)-metazosulfuron (CHEBI:228162) is enantiomer of (S)-metazosulfuron (CHEBI:228163) |
| Incoming Relation(s) |
| metazosulfuron (CHEBI:228161) has part (R)-metazosulfuron (CHEBI:228162) |
| (S)-metazosulfuron (CHEBI:228163) is enantiomer of (R)-metazosulfuron (CHEBI:228162) |
| IUPAC Name |
|---|
| 3-chloro-N-[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]-1-methyl-4-[(5R)-5-methyl-5,6-dihydro-1,4,2-dioxazin-3-yl]-1H-pyrazole-5-sulfonamide |