EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | C[C@H](C[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO4/c1-3(5(8)9)2-4(7)6(10)11/h3-4H,2,7H2,1H3,(H,8,9)(H,10,11)/t3-,4+/m1/s1 |
| InChIKey | KRKRAOXTGDJWNI-DMTCNVIQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | excitatory amino acid agonist An agent that binds to and activates excitatory amino acid receptors. |
| Application: | excitatory amino acid agonist An agent that binds to and activates excitatory amino acid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-4-methyl-L-glutamic acid (CHEBI:228160) has role excitatory amino acid agonist (CHEBI:50103) |
| (4R)-4-methyl-L-glutamic acid (CHEBI:228160) is a 4-methyl-L-glutamic acid (CHEBI:20440) |
| (4R)-4-methyl-L-glutamic acid (CHEBI:228160) is conjugate acid of (4R)-4-methyl-L-glutamate(1−) (CHEBI:45753) |
| Incoming Relation(s) |
| (4R)-4-methyl-L-glutamate(1−) (CHEBI:45753) is conjugate base of (4R)-4-methyl-L-glutamic acid (CHEBI:228160) |
| IUPAC Name |
|---|
| (4R)-4-methyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| (2S,4R)-4-methylglutamic acid | ChEBI |
| erythro-(2S,4R)-4-methyl-L-glutamic acid | ChEBI |
| SYM 2081 | ChEBI |
| SYM-2081 | ChEBI |
| SYM2081 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| SYM-2081 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:31137-74-3 | ChEBI |
| Citations |
|---|