EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14F8S2 |
| Net Charge | 0 |
| Average Mass | 446.428 |
| Monoisotopic Mass | 446.04092 |
| SMILES | Cc1cc(F)c(-c2cc(SCC(F)(F)F)c(C)cc2F)cc1SCC(F)(F)F |
| InChI | InChI=1S/C18H14F8S2/c1-9-3-13(19)11(5-15(9)27-7-17(21,22)23)12-6-16(10(2)4-14(12)20)28-8-18(24,25)26/h3-6H,7-8H2,1-2H3 |
| InChIKey | YZDHQIZLRLUVCB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisulflufen (CHEBI:228159) has role acaricide (CHEBI:22153) |
| bisulflufen (CHEBI:228159) is a aryl sulfide (CHEBI:35683) |
| bisulflufen (CHEBI:228159) is a biphenyls (CHEBI:22888) |
| bisulflufen (CHEBI:228159) is a monofluorobenzenes (CHEBI:83575) |
| IUPAC Name |
|---|
| 2,2'-difluoro-4,4'-dimethyl-5,5'-bis[(2,2,2-trifluoroethyl)sulfanyl]biphenyl |
| Synonyms | Source |
|---|---|
| 2,2'-difluoro-4,4'-dimethyl-5,5'-bis[(2,2,2-trifluoroethyl)sulfanyl]-1,1'-biphenyl | Alan Wood's Pesticides |
| 2,2'-difluoro-4,4'-dimethyl-5,5'-bis[(2,2,2-trifluoroethyl)thio]biphenyl | Alan Wood's Pesticides |
| 2,2'-difluoro-4,4'-dimethyl-5,5'-bis[(2,2,2-trifluoroethyl)thio]-1,1'-biphenyl | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| bisulflufen | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:30171348 | Reaxys |
| CAS:1922957-45-6 | Alan Wood's Pesticides |