EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N3O |
| Net Charge | 0 |
| Average Mass | 283.375 |
| Monoisotopic Mass | 283.16846 |
| SMILES | CN(C)C(=O)Nc1cccc(-c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C17H21N3O/c1-19(2)16-10-8-13(9-11-16)14-6-5-7-15(12-14)18-17(21)20(3)4/h5-12H,1-4H3,(H,18,21) |
| InChIKey | AWOPBSAJHCUSAS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.1.1.3 (triacylglycerol lipase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of triacylglycerol lipase (EC 3.1.1.3). |
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atglistatin (CHEBI:228145) has role cardioprotective agent (CHEBI:77307) |
| atglistatin (CHEBI:228145) has role EC 3.1.1.3 (triacylglycerol lipase) inhibitor (CHEBI:65001) |
| atglistatin (CHEBI:228145) is a aromatic amine (CHEBI:33860) |
| atglistatin (CHEBI:228145) is a biphenyls (CHEBI:22888) |
| atglistatin (CHEBI:228145) is a tertiary amino compound (CHEBI:50996) |
| atglistatin (CHEBI:228145) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 3-[4'-(dimethylamino)[biphenyl]-3-yl]-1,1-dimethylurea |
| Synonym | Source |
|---|---|
| N'-[4'-(dimethylamino)[1,1'-biphenyl]-3-yl]-N,N-dimethylurea | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| HMDB0248698 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1469924-27-3 | ChEBI |
| Citations |
|---|