EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H26O2 |
| Net Charge | 0 |
| Average Mass | 202.338 |
| Monoisotopic Mass | 202.19328 |
| SMILES | CCCCCCCCCCC(O)CO |
| InChI | InChI=1S/C12H26O2/c1-2-3-4-5-6-7-8-9-10-12(14)11-13/h12-14H,2-11H2,1H3 |
| InChIKey | ZITKDVFRMRXIJQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dodecanediol (CHEBI:228133) has role antibacterial agent (CHEBI:33282) |
| 1,2-dodecanediol (CHEBI:228133) has role antifungal agent (CHEBI:35718) |
| 1,2-dodecanediol (CHEBI:228133) is a dodecanediol (CHEBI:195615) |
| 1,2-dodecanediol (CHEBI:228133) is a medium-chain primary fatty alcohol (CHEBI:142605) |
| 1,2-dodecanediol (CHEBI:228133) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| dodecane-1,2-diol |
| Synonyms | Source |
|---|---|
| 1,2-dihydroxydodecane | ChEBI |
| 1,2-dodecylene glycol | ChEBI |
| 2-hydroxylauryl alcohol | ChEBI |
| n-dodecane-1,2-diol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1700179 | Reaxys |
| CAS:1119-87-5 | NIST Chemistry WebBook |
| Citations |
|---|