EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39N7O11 |
| Net Charge | 0 |
| Average Mass | 649.658 |
| Monoisotopic Mass | 649.27076 |
| SMILES | Cc1cccc(O)c1C1=N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H](CCCN(O)C=O)C(=O)N2NCCC[C@@H]2C(=O)NCCC(=O)O)CO1 |
| InChI | InChI=1S/C28H39N7O11/c1-16-5-2-8-21(38)23(16)27-33-19(14-46-27)25(42)32-18(13-36)24(41)31-17(6-4-12-34(45)15-37)28(44)35-20(7-3-10-30-35)26(43)29-11-9-22(39)40/h2,5,8,15,17-20,30,36,38,45H,3-4,6-7,9-14H2,1H3,(H,29,43)(H,31,41)(H,32,42)(H,39,40)/t17-,18+,19+,20-/m1/s1 |
| InChIKey | CEBZKLPHLLOCLA-FUMNGEBKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces gandocaensis (ncbitaxon:1649596) | - | PubMed (26880271) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cahuitamycin C (CHEBI:228111) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 3-[[(3R)-2-[(2R)-5-[ormyl(hydroxy)amino]-2-[[(2S)-3-hydroxy-2-[[(4S)-2-(2-hydroxy-6-methylphenyl)-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]propanoyl]amino]pentanoyl]diazinane-3-carbonyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58196896 | ChemSpider |