EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39N7O12 |
| Net Charge | 0 |
| Average Mass | 653.646 |
| Monoisotopic Mass | 653.26567 |
| SMILES | O=CN(O)CCC[C@@H](NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)c1ccccc1O)C(=O)N1NCCC[C@@H]1C(=O)NCCC(=O)O |
| InChI | InChI=1S/C27H39N7O12/c35-13-18(31-23(41)16-5-1-2-8-21(16)38)25(43)32-19(14-36)24(42)30-17(6-4-12-33(46)15-37)27(45)34-20(7-3-10-29-34)26(44)28-11-9-22(39)40/h1-2,5,8,15,17-20,29,35-36,38,46H,3-4,6-7,9-14H2,(H,28,44)(H,30,42)(H,31,41)(H,32,43)(H,39,40)/t17-,18+,19+,20-/m1/s1 |
| InChIKey | XGZZLYNXFASBPQ-FUMNGEBKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces gandocaensis (ncbitaxon:1649596) | - | PubMed (26880271) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cahuitamycin B (CHEBI:228109) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 3-[[(3R)-2-[(2R)-5-[ormyl(hydroxy)amino]-2-[[(2S)-3-hydroxy-2-[[(2S)-3-hydroxy-2-[(2-hydroxybenzoyl)amino]propanoyl]amino]propanoyl]amino]pentanoyl]diazinane-3-carbonyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58196895 | ChemSpider |