EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O4 |
| Net Charge | 0 |
| Average Mass | 224.256 |
| Monoisotopic Mass | 224.10486 |
| SMILES | CC(=O)CCCc1ccc(C(=O)[C@H](C)O)o1 |
| InChI | InChI=1S/C12H16O4/c1-8(13)4-3-5-10-6-7-11(16-10)12(15)9(2)14/h6-7,9,14H,3-5H2,1-2H3/t9-/m0/s1 |
| InChIKey | CJYSXSUPBIDSPE-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Irpex (ncbitaxon:5318) | - | DOI (10.1016/j.phytol.2019.06.001) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Irpexlacte D (CHEBI:228077) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 5-[5-[(2S)-2-hydroxypropanoyl]uran-2-yl]pentan-2-one |