EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O6 |
| Net Charge | 0 |
| Average Mass | 322.357 |
| Monoisotopic Mass | 322.14164 |
| SMILES | CC(=O)OC[C@@]1(C)CCC[C@@](C)(c2ccc(C(=O)O)cc2O)O1 |
| InChI | InChI=1S/C17H22O6/c1-11(18)22-10-16(2)7-4-8-17(3,23-16)13-6-5-12(15(20)21)9-14(13)19/h5-6,9,19H,4,7-8,10H2,1-3H3,(H,20,21)/t16-,17+/m1/s1 |
| InChIKey | QFLRLCSGTIQEIB-SJORKVTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus versicolor (ncbitaxon:46472) | - | DOI (10.1016/j.phytol.2019.04.023) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7S,11R)-12-acetoxy-sydowic acid (CHEBI:228054) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 4-[(2S,6R)-6-(acetyloxymethyl)-2,6-dimethyloxan-2-yl]-3-hydroxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78429119 | ChemSpider |