EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O4 |
| Net Charge | 0 |
| Average Mass | 262.305 |
| Monoisotopic Mass | 262.12051 |
| SMILES | CCC/C=C/[C@@H]1Cc2cc(O)c(C)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C15H18O4/c1-3-4-5-6-11-7-10-8-12(16)9(2)14(17)13(10)15(18)19-11/h5-6,8,11,16-17H,3-4,7H2,1-2H3/b6-5+/t11-/m1/s1 |
| InChIKey | SKCMXYCMEOCGDG-MVIFTORASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | DOI (10.1016/j.phytol.2016.07.003) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penicisimpin C (CHEBI:228048) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3S)-6,8-dihydroxy-7-methyl-3-[(E)-pent-1-enyl]-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 60597177 | ChemSpider |