EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8Cl2O4 |
| Net Charge | 0 |
| Average Mass | 263.076 |
| Monoisotopic Mass | 261.97996 |
| SMILES | CC[C@H]1OC(=O)c2c(O)c(Cl)c(O)c(Cl)c21 |
| InChI | InChI=1S/C10H8Cl2O4/c1-2-3-4-5(10(15)16-3)8(13)7(12)9(14)6(4)11/h3,13-14H,2H2,1H3/t3-/m1/s1 |
| InChIKey | QLBDBPMUFILYQL-GSVOUGTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spiromastixspecies (ncbitaxon:2044277) | - | PubMed (26686929) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spiromastilactone A (CHEBI:228011) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-4,6-dichloro-3-ethyl-5,7-dihydroxy-3H-2-benzouran-1-one |
| Manual Xrefs | Databases |
|---|---|
| 58197279 | ChemSpider |