EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H39NO16 |
| Net Charge | 0 |
| Average Mass | 729.688 |
| Monoisotopic Mass | 729.22688 |
| SMILES | COc1cc(C)c(C(=O)Oc2cc(C)c(C(=O)Oc3cc(C)c(C(=O)N[C@@H](C)C(=O)O)c(O)c3)c(O[C@H]3O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]3O)c2)c(OC)c1 |
| InChI | InChI=1S/C35H39NO16/c1-14-8-19(10-21(38)25(14)31(42)36-17(4)32(43)44)49-34(46)27-16(3)9-20(50-33(45)26-15(2)7-18(47-5)11-22(26)48-6)12-23(27)51-35-30(41)29(40)28(39)24(13-37)52-35/h7-12,17,24,28-30,35,37-41H,13H2,1-6H3,(H,36,42)(H,43,44)/t17-,24-,28-,29+,30-,35-/m0/s1 |
| InChIKey | URBFANMWRODMRT-QQXCWLMZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humicola (ncbitaxon:5526) | - | PubMed (19942946) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Amidepsine F (CHEBI:227901) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| (2S)-2-[[4-[4-(2,4-dimethoxy-6-methylbenzoyl)oxy-2-methyl-6-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoyl]oxy-2-hydroxy-6-methylbenzoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438386 | ChemSpider |