EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29NO8 |
| Net Charge | 0 |
| Average Mass | 471.506 |
| Monoisotopic Mass | 471.18932 |
| SMILES | C[C@@H]1[C@@H](Nc2ccccc2C(=O)O)[C@@H](C)C(=O)[C@@H](C)[C@@H](O)CC(=O)O[C@@H]1c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C25H29NO8/c1-12-20(29)11-21(30)34-24(15-8-16(27)10-17(28)9-15)14(3)22(13(2)23(12)31)26-19-7-5-4-6-18(19)25(32)33/h4-10,12-14,20,22,24,26-29H,11H2,1-3H3,(H,32,33)/t12-,13+,14+,20-,22-,24-/m0/s1 |
| InChIKey | FJQZRIZEYZKFCA-SMEQSTRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharothrix (ncbitaxon:2071) | - | PubMed (27332142) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Saccharothriolide F (CHEBI:227888) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| 2-[[(2S,3R,4R,5R,7S,8S)-2-(3,5-dihydroxyphenyl)-8-hydroxy-3,5,7-trimethyl-6,10-dioxooxecan-4-yl]amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 76775751 | ChemSpider |