EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:227873 - Ganodermalactone E
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | CC1=CC[C@@H]([C@@H](C)[C@H]2CC[C@@]3(C)C4=C(CC[C@]23C)[C@@]2(CO)CC[C@H](O)C(C)(C)[C@@H]2CC4)OC1=O |
| InChI | InChI=1S/C30H46O4/c1-18-7-9-23(34-26(18)33)19(2)20-11-14-29(6)21-8-10-24-27(3,4)25(32)13-16-30(24,17-31)22(21)12-15-28(20,29)5/h7,19-20,23-25,31-32H,8-17H2,1-6H3/t19-,20+,23-,24-,25-,28+,29-,30-/m0/s1 |
| InChIKey | VNNIDEFVIYLHAM-USLNZALLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma (ncbitaxon:5314) | - | PubMed (24992637) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganodermalactone E (CHEBI:227873) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (2S)-2-[(1S)-1-[(3S,5R,10R,13R,14R,17R)-3-hydroxy-10-(hydroxymethyl)-4,4,13,14-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-5-methyl-2,3-dihydropyran-6-one |
| Manual Xrefs | Databases |
|---|---|
| 78438382 | ChemSpider |