EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O4 |
| Net Charge | 0 |
| Average Mass | 318.413 |
| Monoisotopic Mass | 318.18311 |
| SMILES | C=C[C@]1(C)CCC2=C(C1)[C@H](O)C[C@H]1C(CO)=CC(=O)[C@@H](O)[C@]21C |
| InChI | InChI=1S/C19H26O4/c1-4-18(2)6-5-13-12(9-18)15(21)8-14-11(10-20)7-16(22)17(23)19(13,14)3/h4,7,14-15,17,20-21,23H,1,5-6,8-10H2,2-3H3/t14-,15+,17+,18+,19+/m0/s1 |
| InChIKey | BUUHDERFHDMSIH-ZPKKHLQPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomadura (ncbitaxon:1988) | - | PubMed (27367579) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Actinomadurol (CHEBI:227872) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4S,4aS,7R,9R,10aS)-7-ethenyl-4,9-dihydroxy-1-(hydroxymethyl)-4a,7-dimethyl-5,6,8,9,10,10a-hexahydro-4H-phenanthren-3-one |
| Manual Xrefs | Databases |
|---|---|
| 76776271 | ChemSpider |