EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O4 |
| Net Charge | 0 |
| Average Mass | 280.364 |
| Monoisotopic Mass | 280.16746 |
| SMILES | C=C1CC[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C16H24O4/c1-10-5-6-12-15(2,11(10)9-13(17)18)7-4-8-16(12,3)14(19)20/h11-12H,1,4-9H2,2-3H3,(H,17,18)(H,19,20)/t11-,12+,15+,16-/m0/s1 |
| InChIKey | PWMWTNKJRHUMOB-OJDYBEQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycobacterium tuberculosis (ncbitaxon:1773) | - | DOI (10.1039/p19760002407) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acrostalic acid (CHEBI:227849) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (1S,4aR,5S,8aR)-5-(carboxymethyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443409 | ChemSpider |