EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O8 |
| Net Charge | 0 |
| Average Mass | 362.334 |
| Monoisotopic Mass | 362.10017 |
| SMILES | COc1c2c(c(O)c(-c3c(C)c(OC)c4c(c3O)OCO4)c1C)OCO2 |
| InChI | InChI=1S/C18H18O8/c1-7-9(11(19)15-17(13(7)21-3)25-5-23-15)10-8(2)14(22-4)18-16(12(10)20)24-6-26-18/h19-20H,5-6H2,1-4H3 |
| InChIKey | GCHMSLBRCLIDEX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:2696576) | - | PubMed (21115251) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benzocamphorin E (CHEBI:227807) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 5-(4-hydroxy-7-methoxy-6-methyl-1,3-benzodioxol-5-yl)-7-methoxy-6-methyl-1,3-benzodioxol-4-ol |
| Manual Xrefs | Databases |
|---|---|
| 78435685 | ChemSpider |