EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15NO5 |
| Net Charge | 0 |
| Average Mass | 265.265 |
| Monoisotopic Mass | 265.09502 |
| SMILES | O=C(O)CCCCN1Cc2c(O)cc(O)cc2C1=O |
| InChI | InChI=1S/C13H15NO5/c15-8-5-9-10(11(16)6-8)7-14(13(9)19)4-2-1-3-12(17)18/h5-6,15-16H,1-4,7H2,(H,17,18) |
| InChIKey | HMZRYPLRIDLTNP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Meyerozyma guilliermondii (ncbitaxon:4929) | - | PubMed (26425177) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Meyeroguilline A (CHEBI:227789) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 5-(5,7-dihydroxy-3-oxo-1H-isoindol-2-yl)pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 40256764 | ChemSpider |