EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42O7 |
| Net Charge | 0 |
| Average Mass | 526.670 |
| Monoisotopic Mass | 526.29305 |
| SMILES | CC1=C(C)[C@@]2(C[C@](C)(O)[C@H]3C[C@H](O)[C@@]4(C)C5=CC[C@H]6C(C)(C)C(=O)[C@H](O)C[C@]6(C)C5=C[C@@H](O2)[C@]34C)OC1=O |
| InChI | InChI=1S/C31H42O7/c1-15-16(2)31(38-25(15)35)14-28(6,36)21-12-22(33)29(7)17-9-10-20-26(3,4)24(34)19(32)13-27(20,5)18(17)11-23(37-31)30(21,29)8/h9,11,19-23,32-33,36H,10,12-14H2,1-8H3/t19-,20+,21-,22+,23-,27-,28+,29-,30+,31-/m1/s1 |
| InChIKey | VNUJMOUXAAVKJG-HDSFCPGNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Antrodia heteromorpha (ncbitaxon:157704) | - | PubMed (27266877) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Antrolactone A (CHEBI:227785) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (1S,5R,8R,10S,13R,15R,17S,18S,20S,21R)-8,17,20-trihydroxy-1,3',4',6,6,10,17,21-octamethylspiro[14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicosa-2,11-diene-15,5'-uran]-2',7-dione |
| Manual Xrefs | Databases |
|---|---|
| 76780969 | ChemSpider |