EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O7 |
| Net Charge | 0 |
| Average Mass | 272.253 |
| Monoisotopic Mass | 272.08960 |
| SMILES | COc1cc(C(=O)OC(CO)CO)cc(OC)c1O |
| InChI | InChI=1S/C12H16O7/c1-17-9-3-7(4-10(18-2)11(9)15)12(16)19-8(5-13)6-14/h3-4,8,13-15H,5-6H2,1-2H3 |
| InChIKey | XNWSHCWMPQATIY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inonotus (ncbitaxon:40468) | - | PubMed (17666849) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-3,5-dimethoxy benzoic acid 2-hydroxy-1-(hydroxymethyl)ethyl ester (CHEBI:227773) is a trihydroxybenzoic acid (CHEBI:27115) |
| IUPAC Name |
|---|
| 1,3-dihydroxypropan-2-yl 4-hydroxy-3,5-dimethoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 28284337 | ChemSpider |