EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O7 |
| Net Charge | 0 |
| Average Mass | 450.572 |
| Monoisotopic Mass | 450.26175 |
| SMILES | CC[C@@H](C)[C@H]1C=C[C@H]2[C@H](O)[C@H](OC(=O)C/C(C)=C\C(=O)O)C[C@@H](C)[C@@H]2[C@@]1(C)C(=O)CCO |
| InChI | InChI=1S/C25H38O7/c1-6-15(3)18-8-7-17-23(25(18,5)20(27)9-10-26)16(4)13-19(24(17)31)32-22(30)12-14(2)11-21(28)29/h7-8,11,15-19,23-24,26,31H,6,9-10,12-13H2,1-5H3,(H,28,29)/b14-11-/t15-,16-,17-,18-,19-,23+,24+,25-/m1/s1 |
| InChIKey | SAJDXWMMKMNMKJ-TYKOSLHPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichoderma (ncbitaxon:5543) | - | PubMed (26006715) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tandyukisin D (CHEBI:227765) is a hydroxy fatty acid (CHEBI:24654) |
| IUPAC Name |
|---|
| (Z)-5-[[(1S,2R,4R,4aS,5S,6S,8aR)-6-[(2R)-butan-2-yl]-1-hydroxy-5-(3-hydroxypropanoyl)-4,5-dimethyl-2,3,4,4a,6,8a-hexahydro-1H-naphthalen-2-yl]oxy]-3-methyl-5-oxopent-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 35516997 | ChemSpider |