EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO |
| Net Charge | 0 |
| Average Mass | 165.236 |
| Monoisotopic Mass | 165.11536 |
| SMILES | CC(C)COc1ccccc1N |
| InChI | InChI=1S/C10H15NO/c1-8(2)7-12-10-6-4-3-5-9(10)11/h3-6,8H,7,11H2,1-2H3 |
| InChIKey | YZVXNNKOFAIRIS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brevibacteriumspecies (ncbitaxon:1701) | - | PubMed (26594205) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-isobutoxyphenyl)amine (CHEBI:227749) is a aromatic ether (CHEBI:35618) |
| (2-isobutoxyphenyl)amine (CHEBI:227749) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-(2-methylpropoxy)aniline |
| Manual Xrefs | Databases |
|---|---|
| 12570439 | ChemSpider |