EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H37NO6 |
| Net Charge | 0 |
| Average Mass | 423.550 |
| Monoisotopic Mass | 423.26209 |
| SMILES | CC(C)C[C@H](C)C[C@H](C)/C=C/C(=O)NC1=C[C@](O)(CCCCC(=O)O)[C@@H](O)CC1=O |
| InChI | InChI=1S/C23H37NO6/c1-15(2)11-17(4)12-16(3)8-9-21(27)24-18-14-23(30,20(26)13-19(18)25)10-6-5-7-22(28)29/h8-9,14-17,20,26,30H,5-7,10-13H2,1-4H3,(H,24,27)(H,28,29)/b9-8+/t16-,17+,20+,23-/m1/s1 |
| InChIKey | VFRLDIWVOGUZOS-NMAXYDGISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | DOI (10.20307/nps.2015.21.4.273) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Salternamide E (CHEBI:227744) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 5-[(1R,6S)-1,6-dihydroxy-4-oxo-3-[[(E,4S,6S)-4,6,8-trimethylnon-2-enoyl]amino]cyclohex-2-en-1-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 44210903 | ChemSpider |