EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34N2O7S2 |
| Net Charge | 0 |
| Average Mass | 574.721 |
| Monoisotopic Mass | 574.18074 |
| SMILES | CCCCC[C@H](O)CC(=O)O[C@H]1C=COC=C2C[C@@]3(SC)C(=O)N4c5c(O)cccc5C[C@@]4(SC)C(=O)N3[C@@H]21 |
| InChI | InChI=1S/C28H34N2O7S2/c1-4-5-6-9-19(31)13-22(33)37-21-11-12-36-16-18-15-28(39-3)25(34)29-23-17(8-7-10-20(23)32)14-27(29,38-2)26(35)30(28)24(18)21/h7-8,10-12,16,19,21,24,31-32H,4-6,9,13-15H2,1-3H3/t19-,21-,24-,27+,28+/m0/s1 |
| InChIKey | RCKQRRQPDPVFFY-HNFVFRIRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Graphium (ncbitaxon:76204) | - | DOI (10.20307/nps.2015.21.4.255) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Graphiumin J (CHEBI:227739) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| [(1R,11R,14S,15S)-5-hydroxy-1,11-bis(methylsulanyl)-2,12-dioxo-18-oxa-3,13-diazapentacyclo[11.8.0.03,11.04,9.014,20]henicosa-4(9),5,7,16,19-pentaen-15-yl] (3S)-3-hydroxyoctanoate |
| Manual Xrefs | Databases |
|---|---|
| 44210902 | ChemSpider |