EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H46N6O7 |
| Net Charge | 0 |
| Average Mass | 650.777 |
| Monoisotopic Mass | 650.34280 |
| SMILES | CC(=O)O[C@H](Cc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N1[C@@H](C(=O)NCCCCN=C(N)N)C[C@H]2CC[C@@H](O)C[C@H]21 |
| InChI | InChI=1S/C34H46N6O7/c1-21(41)47-30(18-23-9-12-25(42)13-10-23)32(45)39-27(17-22-7-3-2-4-8-22)33(46)40-28-20-26(43)14-11-24(28)19-29(40)31(44)37-15-5-6-16-38-34(35)36/h2-4,7-10,12-13,24,26-30,42-43H,5-6,11,14-20H2,1H3,(H,37,44)(H,39,45)(H4,35,36,38)/t24-,26-,27-,28-,29-,30-/m1/s1 |
| InChIKey | HUKJPWVQXNHUJQ-HMDGCWDXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis aeruginosa (ncbitaxon:1126) | - | PubMed (22280481) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aeruginosin KT650 (CHEBI:227735) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| [(2R)-1-[[(2R)-1-[(2R,3aR,6R,7aR)-2-[4-(diaminomethylideneamino)butylcarbamoyl]-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxo-3-phenylpropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 28530096 | ChemSpider |