EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28N2O6S2 |
| Net Charge | 0 |
| Average Mass | 528.652 |
| Monoisotopic Mass | 528.13888 |
| SMILES | CCCCC[C@H](O)CC(=O)O[C@H]1C=COC=C2C[C@@]34SS[C@]5(Cc6ccccc6N5C3=O)C(=O)N4[C@@H]21 |
| InChI | InChI=1S/C26H28N2O6S2/c1-2-3-4-8-18(29)12-21(30)34-20-10-11-33-15-17-14-26-23(31)27-19-9-6-5-7-16(19)13-25(27,35-36-26)24(32)28(26)22(17)20/h5-7,9-11,15,18,20,22,29H,2-4,8,12-14H2,1H3/t18-,20-,22-,25+,26+/m0/s1 |
| InChIKey | UGWJLBJDVGMOCP-ANPOYOEPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Graphium (ncbitaxon:76204) | - | DOI (10.20307/nps.2015.21.4.255) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Graphiumin I (CHEBI:227734) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| [(1R,4S,5S,12R)-2,13-dioxo-8-oxa-22,23-dithia-3,14-diazahexacyclo[10.9.2.01,14.03,12.04,10.015,20]tricosa-6,9,15,17,19-pentaen-5-yl] (3S)-3-hydroxyoctanoate |
| Manual Xrefs | Databases |
|---|---|
| 44210901 | ChemSpider |