EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O3 |
| Net Charge | 0 |
| Average Mass | 252.354 |
| Monoisotopic Mass | 252.17254 |
| SMILES | C[C@H]1C=C[C@H]2C[C@H](CO)CC[C@@H]2[C@H]1CCC(=O)O |
| InChI | InChI=1S/C15H24O3/c1-10-2-4-12-8-11(9-16)3-5-14(12)13(10)6-7-15(17)18/h2,4,10-14,16H,3,5-9H2,1H3,(H,17,18)/t10-,11+,12-,13-,14-/m0/s1 |
| InChIKey | IEYGSRROAFACDI-NDKCEZKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (27228159) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[(1S,2S,4aR,6R,8aS)-6-(hydroxymethyl)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]propanoic acid (CHEBI:227733) is a carboxylic acid (CHEBI:33575) |
| IUPAC Name |
|---|
| 3-[(1S,2S,4aR,6R,8aS)-6-(hydroxymethyl)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438897 | ChemSpider |