EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H35ClN2O9S2 |
| Net Charge | 0 |
| Average Mass | 631.169 |
| Monoisotopic Mass | 630.14725 |
| SMILES | CC(=O)OC1c2nc(cs2)C(=O)OC(CCCC(C)Cl)C(C)C(=O)OC(C(C)(C)O)c2nc(cs2)C(=O)OC1(C)C |
| InChI | InChI=1S/C27H35ClN2O9S2/c1-13(28)9-8-10-18-14(2)23(32)38-19(26(4,5)35)21-30-17(12-40-21)25(34)39-27(6,7)20(36-15(3)31)22-29-16(11-41-22)24(33)37-18/h11-14,18-20,35H,8-10H2,1-7H3 |
| InChIKey | NJCRSCPKMAXMKK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Moorena producens JHB (ncbitaxon:1454205) | - | PubMed (26222584) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hectochlorin C (CHEBI:227690) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| [12-(4-chloropentyl)-16-(2-hydroxypropan-2-yl)-4,4,13-trimethyl-2,10,14-trioxo-3,11,15-trioxa-7,18-dithia-20,21-diazatricyclo[15.2.1.16,9]henicosa-1(19),6(21),8,17(20)-tetraen-5-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 40256833 | ChemSpider |