EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H35N3O5 |
| Net Charge | 0 |
| Average Mass | 421.538 |
| Monoisotopic Mass | 421.25767 |
| SMILES | COc1ccc(C[C@H](O)C(=O)N(C)[C@H](C(=O)N(C)[C@H](C(N)=O)C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C22H35N3O5/c1-13(2)18(20(23)27)24(5)22(29)19(14(3)4)25(6)21(28)17(26)12-15-8-10-16(30-7)11-9-15/h8-11,13-14,17-19,26H,12H2,1-7H3,(H2,23,27)/t17-,18-,19-/m0/s1 |
| InChIKey | JVWZZAVZXFCXBV-FHWLQOOXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Moorena producens JHB (ncbitaxon:1454205) | - | PubMed (26222584) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hectoramide (CHEBI:227680) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-hydroxy-3-(4-methoxyphenyl)propanoyl]-methylamino]-3-methylbutanoyl]-methylamino]-3-methylbutanamide |
| Manual Xrefs | Databases |
|---|---|
| 40256831 | ChemSpider |