EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | C=C[C@@]1(C)CCc2c3c(cc(O)c2[C@@H]1O)C(C)(C)[C@H](O)CC3 |
| InChI | InChI=1S/C19H26O3/c1-5-19(4)9-8-12-11-6-7-15(21)18(2,3)13(11)10-14(20)16(12)17(19)22/h5,10,15,17,20-22H,1,6-9H2,2-4H3/t15-,17+,19+/m1/s1 |
| InChIKey | JTSCFAASGVXBPT-AYBZRNKSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (27148955) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspewentin H (CHEBI:227652) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| (1R,2R,7R)-2-ethenyl-2,8,8-trimethyl-1,3,4,5,6,7-hexahydrophenanthrene-1,7,10-triol |
| Manual Xrefs | Databases |
|---|---|
| 58196871 | ChemSpider |