EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O5 |
| Net Charge | 0 |
| Average Mass | 320.385 |
| Monoisotopic Mass | 320.16237 |
| SMILES | CC(=O)CCC[C@H]1CCCCCc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H24O5/c1-12(19)6-5-9-15-8-4-2-3-7-13-10-14(20)11-16(21)17(13)18(22)23-15/h10-11,15,20-21H,2-9H2,1H3/t15-/m1/s1 |
| InChIKey | UEUKKKFUUWSQNA-OAHLLOKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusariumspecies PSU-ES123 (ncbitaxon:1608752) | - | DOI (10.1016/j.tet.2016.08.048) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10'-oxorelgro (CHEBI:227636) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-10,12-dihydroxy-3-(4-oxopentyl)-3,4,5,6,7,8-hexahydro-2-benzoxecin-1-one |
| Manual Xrefs | Databases |
|---|---|
| 58197253 | ChemSpider |