EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N2O8 |
| Net Charge | 0 |
| Average Mass | 348.267 |
| Monoisotopic Mass | 348.05937 |
| SMILES | COc1cc(C2=CC(=O)C(=N)C(C(=O)O)=C2O)c(O)c(C(=O)O)c1N |
| InChI | InChI=1S/C15H12N2O8/c1-25-7-3-5(13(20)9(11(7)17)15(23)24)4-2-6(18)10(16)8(12(4)19)14(21)22/h2-3,16,19-20H,17H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | RODAAKSNFWZQQX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lactarius blennius (ncbitaxon:152933) | - | DOI (10.1021/np0106541) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Blennione (CHEBI:227505) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 2-amino-5-(5-carboxy-6-hydroxy-4-imino-3-oxocyclohexa-1,5-dien-1-yl)-6-hydroxy-3-methoxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435072 | ChemSpider |