EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H35NO2 |
| Net Charge | 0 |
| Average Mass | 345.527 |
| Monoisotopic Mass | 345.26678 |
| SMILES | CCCC/C=C\CCCCC[C@@H](O)[C@H](Cc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C22H35NO2/c1-3-4-5-6-7-8-9-10-14-17-22(25)21(23-19(2)24)18-20-15-12-11-13-16-20/h6-7,11-13,15-16,21-22,25H,3-5,8-10,14,17-18H2,1-2H3,(H,23,24)/b7-6-/t21-,22+/m0/s1 |
| InChIKey | AYOJSPXYLNCMLY-HWEXMVQRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vibriospecies QWI-06 (ncbitaxon:1638654) | - | PubMed (26238555) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vitroprocine J (CHEBI:227482) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| N-[(Z,2S,3R)-3-hydroxy-1-phenyltetradec-9-en-2-yl]acetamide |
| Manual Xrefs | Databases |
|---|---|
| 40256825 | ChemSpider |