EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H43NO3 |
| Net Charge | 0 |
| Average Mass | 417.634 |
| Monoisotopic Mass | 417.32429 |
| SMILES | CCCCCCCCCCC/C=C\CC[C@@H](O)[C@H](Cc1ccc(O)cc1)NC(C)=O |
| InChI | InChI=1S/C26H43NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-26(30)25(27-22(2)28)21-23-17-19-24(29)20-18-23/h13-14,17-20,25-26,29-30H,3-12,15-16,21H2,1-2H3,(H,27,28)/b14-13-/t25-,26+/m0/s1 |
| InChIKey | BMECFWYLJPTHGG-AOWOLNFQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vibriospecies QWI-06 (ncbitaxon:1638654) | - | PubMed (26238555) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vitroprocine G (CHEBI:227466) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| N-[(Z,2S,3R)-3-hydroxy-1-(4-hydroxyphenyl)octadec-6-en-2-yl]acetamide |
| Manual Xrefs | Databases |
|---|---|
| 40256822 | ChemSpider |