EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21NO3 |
| Net Charge | 0 |
| Average Mass | 251.326 |
| Monoisotopic Mass | 251.15214 |
| SMILES | CCCCc1ccc(C(=O)O[C@H](C)[C@@H](C)O)nc1 |
| InChI | InChI=1S/C14H21NO3/c1-4-5-6-12-7-8-13(15-9-12)14(17)18-11(3)10(2)16/h7-11,16H,4-6H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | SUNALTYKQWMYGQ-GHMZBOCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium solani (ncbitaxon:169388) | - | PubMed (30447545) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusaricate H (CHEBI:227452) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| IUPAC Name |
|---|
| [(2R,3R)-3-hydroxybutan-2-yl] 5-butylpyridine-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 71360628 | ChemSpider |